C7H15N2O4P — CID 14850749
[(2R,4S)-2-carbamoylpiperidin-4-yl]methylphosphonic acid (PubChem CID 14850749) has the molecular formula C7H15N2O4P and a molecular weight of 222.18 g/mol. Its IUPAC name is [(2R,4S)-2-carbamoylpiperidin-4-yl]methylphosphonic acid.
| Compound Name | [(2R,4S)-2-carbamoylpiperidin-4-yl]methylphosphonic acid |
|---|---|
| PubChem CID | 14850749 |
| Molecular Formula | C7H15N2O4P |
| Molecular Weight | 222.18 g/mol |
| Exact Mass | 222.08 |
| IUPAC Name | [(2R,4S)-2-carbamoylpiperidin-4-yl]methylphosphonic acid |
| SMILES | NC(=O)[C@H]1C[C@@H](CP(=O)(O)O)CCN1 |
| InChI | InChI=1S/C7H15N2O4P/c8-7(10)6-3-5(1-2-9-6)4-14(11,12)13/h5-6,9H,1-4H2,(H2,8,10)(H2,11,12,13)/t5-,6+/m0/s1 |
| InChIKey | TVXULZQNJJZDGN-NTSWFWBYSA-N |
| XLogP | -0.98 |
| TPSA | 112.65 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.18 |
| LogP ≤ 5 | -0.98 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|