[(2R,4S)-2-carbamoylpiperidin-4-yl]methylphosphonic acid

C7H15N2O4P — CID 14850749

IUPAC[(2R,4S)-2-carbamoylpiperidin-4-yl]methylphosphonic acid
SMILESNC(=O)[C@H]1C[C@@H](CP(=O)(O)O)CCN1
InChIInChI=1S/C7H15N2O4P/c8-7(10)6-3-5(1-2-9-6)4-14(11,12)13/h5-6,9H,1-4H2,(H2,8,10)(H2,11,12,13)/t5-,6+/m0/s1
InChIKeyTVXULZQNJJZDGN-NTSWFWBYSA-N
MW222.18 g/mol
LogP-0.98
Rot. Bonds3

About [(2R,4S)-2-carbamoylpiperidin-4-yl]methylphosphonic acid

[(2R,4S)-2-carbamoylpiperidin-4-yl]methylphosphonic acid (PubChem CID 14850749) has the molecular formula C7H15N2O4P and a molecular weight of 222.18 g/mol. Its IUPAC name is [(2R,4S)-2-carbamoylpiperidin-4-yl]methylphosphonic acid.

Molecular Properties

Compound Name[(2R,4S)-2-carbamoylpiperidin-4-yl]methylphosphonic acid
PubChem CID14850749
Molecular FormulaC7H15N2O4P
Molecular Weight222.18 g/mol
Exact Mass222.08
IUPAC Name[(2R,4S)-2-carbamoylpiperidin-4-yl]methylphosphonic acid
SMILESNC(=O)[C@H]1C[C@@H](CP(=O)(O)O)CCN1
InChIInChI=1S/C7H15N2O4P/c8-7(10)6-3-5(1-2-9-6)4-14(11,12)13/h5-6,9H,1-4H2,(H2,8,10)(H2,11,12,13)/t5-,6+/m0/s1
InChIKeyTVXULZQNJJZDGN-NTSWFWBYSA-N
XLogP-0.98
TPSA112.65 Ų
H-Bond Donors4
H-Bond Acceptors3
Rotatable Bonds3
Heavy Atoms14
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500222.18
LogP ≤ 5-0.98
H-Bond Donors ≤ 54
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'phosphor', 'substructure': 'N/A'}

Analyze [(2R,4S)-2-carbamoylpiperidin-4-yl]methylphosphonic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of [(2R,4S)-2-carbamoylpiperidin-4-yl]methylphosphonic acid?
The IUPAC name of [(2R,4S)-2-carbamoylpiperidin-4-yl]methylphosphonic acid (CID 14850749) is [(2R,4S)-2-carbamoylpiperidin-4-yl]methylphosphonic acid.
What is the SMILES notation for [(2R,4S)-2-carbamoylpiperidin-4-yl]methylphosphonic acid?
The canonical SMILES for [(2R,4S)-2-carbamoylpiperidin-4-yl]methylphosphonic acid is NC(=O)[C@H]1C[C@@H](CP(=O)(O)O)CCN1.
What is the InChIKey of [(2R,4S)-2-carbamoylpiperidin-4-yl]methylphosphonic acid?
The InChIKey is TVXULZQNJJZDGN-NTSWFWBYSA-N. The full InChI is InChI=1S/C7H15N2O4P/c8-7(10)6-3-5(1-2-9-6)4-14(11,12)13/h5-6,9H,1-4H2,(H2,8,10)(H2,11,12,13)/t5-,6+/m0/s1.
What are the key properties of [(2R,4S)-2-carbamoylpiperidin-4-yl]methylphosphonic acid?
[(2R,4S)-2-carbamoylpiperidin-4-yl]methylphosphonic acid has a molecular weight of 222.18 g/mol, XLogP of -0.98, 3 rotatable bonds, 4 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [(2R,4S)-2-carbamoylpiperidin-4-yl]methylphosphonic acid is sourced from PubChem (CID 14850749), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).