C13H16F2N2O — CID 106781724
4-[(2,6-difluorophenyl)methyl]piperidine-2-carboxamide (PubChem CID 106781724) has the molecular formula C13H16F2N2O and a molecular weight of 254.28 g/mol. Its IUPAC name is 4-[(2,6-difluorophenyl)methyl]piperidine-2-carboxamide.
| Compound Name | 4-[(2,6-difluorophenyl)methyl]piperidine-2-carboxamide |
|---|---|
| PubChem CID | 106781724 |
| Molecular Formula | C13H16F2N2O |
| Molecular Weight | 254.28 g/mol |
| Exact Mass | 254.12 |
| IUPAC Name | 4-[(2,6-difluorophenyl)methyl]piperidine-2-carboxamide |
| SMILES | NC(=O)C1CC(Cc2c(F)cccc2F)CCN1 |
| InChI | InChI=1S/C13H16F2N2O/c14-10-2-1-3-11(15)9(10)6-8-4-5-17-12(7-8)13(16)18/h1-3,8,12,17H,4-7H2,(H2,16,18) |
| InChIKey | FLBLELGMMMMCDK-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.28 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |