C12H14F2N2O — CID 115502756
4-(2,3-difluorophenyl)piperidine-2-carboxamide (PubChem CID 115502756) has the molecular formula C12H14F2N2O and a molecular weight of 240.25 g/mol. Its IUPAC name is 4-(2,3-difluorophenyl)piperidine-2-carboxamide.
| Compound Name | 4-(2,3-difluorophenyl)piperidine-2-carboxamide |
|---|---|
| PubChem CID | 115502756 |
| Molecular Formula | C12H14F2N2O |
| Molecular Weight | 240.25 g/mol |
| Exact Mass | 240.11 |
| IUPAC Name | 4-(2,3-difluorophenyl)piperidine-2-carboxamide |
| SMILES | NC(=O)C1CC(c2cccc(F)c2F)CCN1 |
| InChI | InChI=1S/C12H14F2N2O/c13-9-3-1-2-8(11(9)14)7-4-5-16-10(6-7)12(15)17/h1-3,7,10,16H,4-6H2,(H2,15,17) |
| InChIKey | VCWKYOXKMDRNQG-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.25 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |