C11H13F2N — CID 93478481
(3R)-3-(2,3-difluorophenyl)piperidine (PubChem CID 93478481) has the molecular formula C11H13F2N and a molecular weight of 197.23 g/mol. Its IUPAC name is (3R)-3-(2,3-difluorophenyl)piperidine.
| Compound Name | (3R)-3-(2,3-difluorophenyl)piperidine |
|---|---|
| PubChem CID | 93478481 |
| Molecular Formula | C11H13F2N |
| Molecular Weight | 197.23 g/mol |
| Exact Mass | 197.10 |
| IUPAC Name | (3R)-3-(2,3-difluorophenyl)piperidine |
| SMILES | Fc1cccc([C@H]2CCCNC2)c1F |
| InChI | InChI=1S/C11H13F2N/c12-10-5-1-4-9(11(10)13)8-3-2-6-14-7-8/h1,4-5,8,14H,2-3,6-7H2/t8-/m0/s1 |
| InChIKey | JYGMKVCYGBCLEO-QMMMGPOBSA-N |
| XLogP | 2.43 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.23 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |