C13H26NO5P — CID 54250756
ethyl (2S,4R)-4-(diethoxyphosphorylmethyl)piperidine-2-carboxylate (PubChem CID 54250756) has the molecular formula C13H26NO5P and a molecular weight of 307.33 g/mol. Its IUPAC name is ethyl (2S,4R)-4-(diethoxyphosphorylmethyl)piperidine-2-carboxylate.
| Compound Name | ethyl (2S,4R)-4-(diethoxyphosphorylmethyl)piperidine-2-carboxylate |
|---|---|
| PubChem CID | 54250756 |
| Molecular Formula | C13H26NO5P |
| Molecular Weight | 307.33 g/mol |
| Exact Mass | 307.15 |
| IUPAC Name | ethyl (2S,4R)-4-(diethoxyphosphorylmethyl)piperidine-2-carboxylate |
| SMILES | CCOC(=O)[C@@H]1C[C@H](CP(=O)(OCC)OCC)CCN1 |
| InChI | InChI=1S/C13H26NO5P/c1-4-17-13(15)12-9-11(7-8-14-12)10-20(16,18-5-2)19-6-3/h11-12,14H,4-10H2,1-3H3/t11-,12+/m1/s1 |
| InChIKey | QWODVTDMCBTJHX-NEPJUHHUSA-N |
| XLogP | 2.18 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.33 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|