C19H34NO7P — CID 10342013
3-O-ethyl 2-O-methyl (3R,4aS,6S,8aS)-6-(diethoxyphosphorylmethyl)-3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinoline-2,3-dicarboxylate (PubChem CID 10342013) has the molecular formula C19H34NO7P and a molecular weight of 419.46 g/mol. Its IUPAC name is 3-O-ethyl 2-O-methyl (3R,4aS,6S,8aS)-6-(diethoxyphosphorylmethyl)-3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinoline-2,3-dicarboxylate.
| Compound Name | 3-O-ethyl 2-O-methyl (3R,4aS,6S,8aS)-6-(diethoxyphosphorylmethyl)-3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinoline-2,3-dicarboxylate |
|---|---|
| PubChem CID | 10342013 |
| Molecular Formula | C19H34NO7P |
| Molecular Weight | 419.46 g/mol |
| Exact Mass | 419.21 |
| IUPAC Name | 3-O-ethyl 2-O-methyl (3R,4aS,6S,8aS)-6-(diethoxyphosphorylmethyl)-3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinoline-2,3-dicarboxylate |
| SMILES | CCOC(=O)[C@H]1C[C@@H]2C[C@@H](CP(=O)(OCC)OCC)CC[C@@H]2CN1C(=O)OC |
| InChI | InChI=1S/C19H34NO7P/c1-5-25-18(21)17-11-16-10-14(13-28(23,26-6-2)27-7-3)8-9-15(16)12-20(17)19(22)24-4/h14-17H,5-13H2,1-4H3/t14-,15+,16-,17+/m0/s1 |
| InChIKey | GVBAHXGOGALNKV-VVLHAWIVSA-N |
| XLogP | 3.69 |
| TPSA | 91.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.46 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|