C18H26N2O4 — CID 57242391
3-O-ethyl 2-O-methyl 6-(1-cyanoprop-1-en-2-yl)-3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinoline-2,3-dicarboxylate (PubChem CID 57242391) has the molecular formula C18H26N2O4 and a molecular weight of 334.42 g/mol. Its IUPAC name is 3-O-ethyl 2-O-methyl 6-(1-cyanoprop-1-en-2-yl)-3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinoline-2,3-dicarboxylate.
| Compound Name | 3-O-ethyl 2-O-methyl 6-(1-cyanoprop-1-en-2-yl)-3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinoline-2,3-dicarboxylate |
|---|---|
| PubChem CID | 57242391 |
| Molecular Formula | C18H26N2O4 |
| Molecular Weight | 334.42 g/mol |
| Exact Mass | 334.19 |
| IUPAC Name | 3-O-ethyl 2-O-methyl 6-(1-cyanoprop-1-en-2-yl)-3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinoline-2,3-dicarboxylate |
| SMILES | CCOC(=O)C1CC2CC(C(C)=CC#N)CCC2CN1C(=O)OC |
| InChI | InChI=1S/C18H26N2O4/c1-4-24-17(21)16-10-15-9-13(12(2)7-8-19)5-6-14(15)11-20(16)18(22)23-3/h7,13-16H,4-6,9-11H2,1-3H3 |
| InChIKey | AJJIOHIZALYFLD-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 79.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.42 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|