C23H28N2O4 — CID 54355249
3-O-ethyl 2-O-methyl 6-(2-cyano-1-phenylethenyl)-3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinoline-2,3-dicarboxylate (PubChem CID 54355249) has the molecular formula C23H28N2O4 and a molecular weight of 396.49 g/mol. Its IUPAC name is 3-O-ethyl 2-O-methyl 6-(2-cyano-1-phenylethenyl)-3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinoline-2,3-dicarboxylate.
| Compound Name | 3-O-ethyl 2-O-methyl 6-(2-cyano-1-phenylethenyl)-3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinoline-2,3-dicarboxylate |
|---|---|
| PubChem CID | 54355249 |
| Molecular Formula | C23H28N2O4 |
| Molecular Weight | 396.49 g/mol |
| Exact Mass | 396.20 |
| IUPAC Name | 3-O-ethyl 2-O-methyl 6-(2-cyano-1-phenylethenyl)-3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinoline-2,3-dicarboxylate |
| SMILES | CCOC(=O)C1CC2CC(C(=CC#N)c3ccccc3)CCC2CN1C(=O)OC |
| InChI | InChI=1S/C23H28N2O4/c1-3-29-22(26)21-14-19-13-17(9-10-18(19)15-25(21)23(27)28-2)20(11-12-24)16-7-5-4-6-8-16/h4-8,11,17-19,21H,3,9-10,13-15H2,1-2H3 |
| InChIKey | UIQZNSYPWAISKU-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 79.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.49 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|