C22H35BrN2O6 — CID 22294119
3-O-ethyl 2-O-methyl 6-[(4-bromo-2-ethoxycarbonylpyrrolidin-1-yl)methyl]-3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinoline-2,3-dicarboxylate (PubChem CID 22294119) has the molecular formula C22H35BrN2O6 and a molecular weight of 503.43 g/mol. Its IUPAC name is 3-O-ethyl 2-O-methyl 6-[(4-bromo-2-ethoxycarbonylpyrrolidin-1-yl)methyl]-3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinoline-2,3-dicarboxylate.
| Compound Name | 3-O-ethyl 2-O-methyl 6-[(4-bromo-2-ethoxycarbonylpyrrolidin-1-yl)methyl]-3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinoline-2,3-dicarboxylate |
|---|---|
| PubChem CID | 22294119 |
| Molecular Formula | C22H35BrN2O6 |
| Molecular Weight | 503.43 g/mol |
| Exact Mass | 502.17 |
| IUPAC Name | 3-O-ethyl 2-O-methyl 6-[(4-bromo-2-ethoxycarbonylpyrrolidin-1-yl)methyl]-3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinoline-2,3-dicarboxylate |
| SMILES | CCOC(=O)C1CC(Br)CN1CC1CCC2CN(C(=O)OC)C(C(=O)OCC)CC2C1 |
| InChI | InChI=1S/C22H35BrN2O6/c1-4-30-20(26)18-10-17(23)13-24(18)11-14-6-7-15-12-25(22(28)29-3)19(9-16(15)8-14)21(27)31-5-2/h14-19H,4-13H2,1-3H3 |
| InChIKey | DNXHTMIHYNJPKJ-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 85.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.43 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|