C25H42N2O7 — CID 90869138
2-O-tert-butyl 3-O-ethyl (6S,8aR)-6-[[(2S,4R)-2-ethoxycarbonyl-4-hydroxypyrrolidin-1-yl]methyl]-3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinoline-2,3-dicarboxylate (PubChem CID 90869138) has the molecular formula C25H42N2O7 and a molecular weight of 482.62 g/mol. Its IUPAC name is 2-O-tert-butyl 3-O-ethyl (6S,8aR)-6-[[(2S,4R)-2-ethoxycarbonyl-4-hydroxypyrrolidin-1-yl]methyl]-3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinoline-2,3-dicarboxylate.
| Compound Name | 2-O-tert-butyl 3-O-ethyl (6S,8aR)-6-[[(2S,4R)-2-ethoxycarbonyl-4-hydroxypyrrolidin-1-yl]methyl]-3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinoline-2,3-dicarboxylate |
|---|---|
| PubChem CID | 90869138 |
| Molecular Formula | C25H42N2O7 |
| Molecular Weight | 482.62 g/mol |
| Exact Mass | 482.30 |
| IUPAC Name | 2-O-tert-butyl 3-O-ethyl (6S,8aR)-6-[[(2S,4R)-2-ethoxycarbonyl-4-hydroxypyrrolidin-1-yl]methyl]-3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinoline-2,3-dicarboxylate |
| SMILES | CCOC(=O)C1CC2C[C@@H](CN3C[C@H](O)C[C@H]3C(=O)OCC)CC[C@H]2CN1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C25H42N2O7/c1-6-32-22(29)20-12-19(28)15-26(20)13-16-8-9-17-14-27(24(31)34-25(3,4)5)21(11-18(17)10-16)23(30)33-7-2/h16-21,28H,6-15H2,1-5H3/t16-,17-,18?,19+,20-,21?/m0/s1 |
| InChIKey | FYTRJRBUMVRTIH-PIZCATRGSA-N |
| XLogP | 2.59 |
| TPSA | 105.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.62 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|