C17H32NO6P — CID 19009207
methyl 6-(diethoxyphosphorylmethyl)-3-methoxy-3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinoline-2-carboxylate (PubChem CID 19009207) has the molecular formula C17H32NO6P and a molecular weight of 377.42 g/mol. Its IUPAC name is methyl 6-(diethoxyphosphorylmethyl)-3-methoxy-3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinoline-2-carboxylate.
| Compound Name | methyl 6-(diethoxyphosphorylmethyl)-3-methoxy-3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinoline-2-carboxylate |
|---|---|
| PubChem CID | 19009207 |
| Molecular Formula | C17H32NO6P |
| Molecular Weight | 377.42 g/mol |
| Exact Mass | 377.20 |
| IUPAC Name | methyl 6-(diethoxyphosphorylmethyl)-3-methoxy-3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinoline-2-carboxylate |
| SMILES | CCOP(=O)(CC1CCC2CN(C(=O)OC)C(OC)CC2C1)OCC |
| InChI | InChI=1S/C17H32NO6P/c1-5-23-25(20,24-6-2)12-13-7-8-14-11-18(17(19)22-4)16(21-3)10-15(14)9-13/h13-16H,5-12H2,1-4H3 |
| InChIKey | WYUBGFQAKGTAKC-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 74.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.42 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|