C13H24NO5P — CID 14877989
(3-ethoxycarbonyl-1,2,3,4,4a,5,6,7,8,8a-decahydroisoquinolin-6-yl)methylphosphonic acid (PubChem CID 14877989) has the molecular formula C13H24NO5P and a molecular weight of 305.31 g/mol. Its IUPAC name is (3-ethoxycarbonyl-1,2,3,4,4a,5,6,7,8,8a-decahydroisoquinolin-6-yl)methylphosphonic acid.
| Compound Name | (3-ethoxycarbonyl-1,2,3,4,4a,5,6,7,8,8a-decahydroisoquinolin-6-yl)methylphosphonic acid |
|---|---|
| PubChem CID | 14877989 |
| Molecular Formula | C13H24NO5P |
| Molecular Weight | 305.31 g/mol |
| Exact Mass | 305.14 |
| IUPAC Name | (3-ethoxycarbonyl-1,2,3,4,4a,5,6,7,8,8a-decahydroisoquinolin-6-yl)methylphosphonic acid |
| SMILES | CCOC(=O)C1CC2CC(CP(=O)(O)O)CCC2CN1 |
| InChI | InChI=1S/C13H24NO5P/c1-2-19-13(15)12-6-11-5-9(8-20(16,17)18)3-4-10(11)7-14-12/h9-12,14H,2-8H2,1H3,(H2,16,17,18) |
| InChIKey | XBUSYJKJBDQMFT-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 95.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.31 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|