C21H39N5O4 — CID 168971549
6-acetyloxyhexyl 6-[(3Z)-3-amino-3-(aminohydrazinylidene)propyl]-1,2,3,4,4a,5,6,7,8,8a-decahydroisoquinoline-3-carboxylate (PubChem CID 168971549) has the molecular formula C21H39N5O4 and a molecular weight of 425.57 g/mol. Its IUPAC name is 6-acetyloxyhexyl 6-[(3Z)-3-amino-3-(aminohydrazinylidene)propyl]-1,2,3,4,4a,5,6,7,8,8a-decahydroisoquinoline-3-carboxylate.
| Compound Name | 6-acetyloxyhexyl 6-[(3Z)-3-amino-3-(aminohydrazinylidene)propyl]-1,2,3,4,4a,5,6,7,8,8a-decahydroisoquinoline-3-carboxylate |
|---|---|
| PubChem CID | 168971549 |
| Molecular Formula | C21H39N5O4 |
| Molecular Weight | 425.57 g/mol |
| Exact Mass | 425.30 |
| IUPAC Name | 6-acetyloxyhexyl 6-[(3Z)-3-amino-3-(aminohydrazinylidene)propyl]-1,2,3,4,4a,5,6,7,8,8a-decahydroisoquinoline-3-carboxylate |
| SMILES | CC(=O)OCCCCCCOC(=O)C1CC2CC(CC/C(N)=N/NN)CCC2CN1 |
| InChI | InChI=1S/C21H39N5O4/c1-15(27)29-10-4-2-3-5-11-30-21(28)19-13-18-12-16(6-8-17(18)14-24-19)7-9-20(22)25-26-23/h16-19,24,26H,2-14,23H2,1H3,(H2,22,25) |
| InChIKey | XSEIDKSWGUZAOQ-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 141.06 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.57 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|