C18H29N5O4 — CID 168971577
[(2R)-1-ethoxy-1-oxopropan-2-yl] (3S)-6-[2-(2H-tetrazol-5-yl)ethyl]-1,2,3,4,4a,5,6,7,8,8a-decahydroisoquinoline-3-carboxylate (PubChem CID 168971577) has the molecular formula C18H29N5O4 and a molecular weight of 379.46 g/mol. Its IUPAC name is [(2R)-1-ethoxy-1-oxopropan-2-yl] (3S)-6-[2-(2H-tetrazol-5-yl)ethyl]-1,2,3,4,4a,5,6,7,8,8a-decahydroisoquinoline-3-carboxylate.
| Compound Name | [(2R)-1-ethoxy-1-oxopropan-2-yl] (3S)-6-[2-(2H-tetrazol-5-yl)ethyl]-1,2,3,4,4a,5,6,7,8,8a-decahydroisoquinoline-3-carboxylate |
|---|---|
| PubChem CID | 168971577 |
| Molecular Formula | C18H29N5O4 |
| Molecular Weight | 379.46 g/mol |
| Exact Mass | 379.22 |
| IUPAC Name | [(2R)-1-ethoxy-1-oxopropan-2-yl] (3S)-6-[2-(2H-tetrazol-5-yl)ethyl]-1,2,3,4,4a,5,6,7,8,8a-decahydroisoquinoline-3-carboxylate |
| SMILES | CCOC(=O)[C@@H](C)OC(=O)[C@@H]1CC2CC(CCc3nn[nH]n3)CCC2CN1 |
| InChI | InChI=1S/C18H29N5O4/c1-3-26-17(24)11(2)27-18(25)15-9-14-8-12(4-6-13(14)10-19-15)5-7-16-20-22-23-21-16/h11-15,19H,3-10H2,1-2H3,(H,20,21,22,23)/t11-,12?,13?,14?,15+/m1/s1 |
| InChIKey | SSLBYUIKBCFJFE-KLDMJIFRSA-N |
| XLogP | 1.02 |
| TPSA | 119.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.46 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |