C19H31N5O4 — CID 177068784
[(2R)-4-ethoxy-4-oxobutan-2-yl] (3S,4aR,6R,8aR)-1,1,3-trideuterio-6-[2-(2H-tetrazol-5-yl)ethyl]-2,4,4a,5,6,7,8,8a-octahydroisoquinoline-3-carboxylate (PubChem CID 177068784) has the molecular formula C19H31N5O4 and a molecular weight of 396.51 g/mol. Its IUPAC name is [(2R)-4-ethoxy-4-oxobutan-2-yl] (3S,4aR,6R,8aR)-1,1,3-trideuterio-6-[2-(2H-tetrazol-5-yl)ethyl]-2,4,4a,5,6,7,8,8a-octahydroisoquinoline-3-carboxylate.
| Compound Name | [(2R)-4-ethoxy-4-oxobutan-2-yl] (3S,4aR,6R,8aR)-1,1,3-trideuterio-6-[2-(2H-tetrazol-5-yl)ethyl]-2,4,4a,5,6,7,8,8a-octahydroisoquinoline-3-carboxylate |
|---|---|
| PubChem CID | 177068784 |
| Molecular Formula | C19H31N5O4 |
| Molecular Weight | 396.51 g/mol |
| Exact Mass | 396.26 |
| IUPAC Name | [(2R)-4-ethoxy-4-oxobutan-2-yl] (3S,4aR,6R,8aR)-1,1,3-trideuterio-6-[2-(2H-tetrazol-5-yl)ethyl]-2,4,4a,5,6,7,8,8a-octahydroisoquinoline-3-carboxylate |
| SMILES | [2H]C1([2H])N[C@]([2H])(C(=O)O[C@H](C)CC(=O)OCC)C[C@H]2C[C@@H](CCc3nn[nH]n3)CC[C@H]21 |
| InChI | InChI=1S/C19H31N5O4/c1-3-27-18(25)8-12(2)28-19(26)16-10-15-9-13(4-6-14(15)11-20-16)5-7-17-21-23-24-22-17/h12-16,20H,3-11H2,1-2H3,(H,21,22,23,24)/t12-,13-,14+,15-,16+/m1/s1/i11D2,16D |
| InChIKey | FMXLEKLJINQKDX-AMXBHDGZSA-N |
| XLogP | 1.41 |
| TPSA | 119.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.51 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |