C18H30N6O3 — CID 177068782
2-[acetyl(methyl)amino]ethyl (3S,4aR,6R,8aR)-3-deuterio-6-[2-(2H-tetrazol-5-yl)ethyl]-2,4,4a,5,6,7,8,8a-octahydro-1H-isoquinoline-3-carboxylate (PubChem CID 177068782) has the molecular formula C18H30N6O3 and a molecular weight of 379.48 g/mol. Its IUPAC name is 2-[acetyl(methyl)amino]ethyl (3S,4aR,6R,8aR)-3-deuterio-6-[2-(2H-tetrazol-5-yl)ethyl]-2,4,4a,5,6,7,8,8a-octahydro-1H-isoquinoline-3-carboxylate.
| Compound Name | 2-[acetyl(methyl)amino]ethyl (3S,4aR,6R,8aR)-3-deuterio-6-[2-(2H-tetrazol-5-yl)ethyl]-2,4,4a,5,6,7,8,8a-octahydro-1H-isoquinoline-3-carboxylate |
|---|---|
| PubChem CID | 177068782 |
| Molecular Formula | C18H30N6O3 |
| Molecular Weight | 379.48 g/mol |
| Exact Mass | 379.24 |
| IUPAC Name | 2-[acetyl(methyl)amino]ethyl (3S,4aR,6R,8aR)-3-deuterio-6-[2-(2H-tetrazol-5-yl)ethyl]-2,4,4a,5,6,7,8,8a-octahydro-1H-isoquinoline-3-carboxylate |
| SMILES | [2H][C@@]1(C(=O)OCCN(C)C(C)=O)C[C@H]2C[C@@H](CCc3nn[nH]n3)CC[C@H]2CN1 |
| InChI | InChI=1S/C18H30N6O3/c1-12(25)24(2)7-8-27-18(26)16-10-15-9-13(3-5-14(15)11-19-16)4-6-17-20-22-23-21-17/h13-16,19H,3-11H2,1-2H3,(H,20,21,22,23)/t13-,14+,15-,16+/m1/s1/i16D |
| InChIKey | KZPCAEBTRXFVOK-VROSPPLGSA-N |
| XLogP | 0.55 |
| TPSA | 113.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.48 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |