C20H33N5O4 — CID 177068810
(5-ethoxy-5-oxopentyl) (3S,4aR,6R,8aR)-3-deuterio-6-[2-(2H-tetrazol-5-yl)ethyl]-2,4,4a,5,6,7,8,8a-octahydro-1H-isoquinoline-3-carboxylate (PubChem CID 177068810) has the molecular formula C20H33N5O4 and a molecular weight of 408.52 g/mol. Its IUPAC name is (5-ethoxy-5-oxopentyl) (3S,4aR,6R,8aR)-3-deuterio-6-[2-(2H-tetrazol-5-yl)ethyl]-2,4,4a,5,6,7,8,8a-octahydro-1H-isoquinoline-3-carboxylate.
| Compound Name | (5-ethoxy-5-oxopentyl) (3S,4aR,6R,8aR)-3-deuterio-6-[2-(2H-tetrazol-5-yl)ethyl]-2,4,4a,5,6,7,8,8a-octahydro-1H-isoquinoline-3-carboxylate |
|---|---|
| PubChem CID | 177068810 |
| Molecular Formula | C20H33N5O4 |
| Molecular Weight | 408.52 g/mol |
| Exact Mass | 408.26 |
| IUPAC Name | (5-ethoxy-5-oxopentyl) (3S,4aR,6R,8aR)-3-deuterio-6-[2-(2H-tetrazol-5-yl)ethyl]-2,4,4a,5,6,7,8,8a-octahydro-1H-isoquinoline-3-carboxylate |
| SMILES | [2H][C@@]1(C(=O)OCCCCC(=O)OCC)C[C@H]2C[C@@H](CCc3nn[nH]n3)CC[C@H]2CN1 |
| InChI | InChI=1S/C20H33N5O4/c1-2-28-19(26)5-3-4-10-29-20(27)17-12-16-11-14(6-8-15(16)13-21-17)7-9-18-22-24-25-23-18/h14-17,21H,2-13H2,1H3,(H,22,23,24,25)/t14-,15+,16-,17+/m1/s1/i17D |
| InChIKey | CXZQMWSXROSULM-QDSQYIBKSA-N |
| XLogP | 1.80 |
| TPSA | 119.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.52 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|