C19H36N6O4 — CID 168971425
3-(ethylcarbamoyloxy)propyl 6-[(3Z)-3-amino-3-(aminohydrazinylidene)propyl]-1,2,3,4,4a,5,6,7,8,8a-decahydroisoquinoline-3-carboxylate (PubChem CID 168971425) has the molecular formula C19H36N6O4 and a molecular weight of 412.54 g/mol. Its IUPAC name is 3-(ethylcarbamoyloxy)propyl 6-[(3Z)-3-amino-3-(aminohydrazinylidene)propyl]-1,2,3,4,4a,5,6,7,8,8a-decahydroisoquinoline-3-carboxylate.
| Compound Name | 3-(ethylcarbamoyloxy)propyl 6-[(3Z)-3-amino-3-(aminohydrazinylidene)propyl]-1,2,3,4,4a,5,6,7,8,8a-decahydroisoquinoline-3-carboxylate |
|---|---|
| PubChem CID | 168971425 |
| Molecular Formula | C19H36N6O4 |
| Molecular Weight | 412.54 g/mol |
| Exact Mass | 412.28 |
| IUPAC Name | 3-(ethylcarbamoyloxy)propyl 6-[(3Z)-3-amino-3-(aminohydrazinylidene)propyl]-1,2,3,4,4a,5,6,7,8,8a-decahydroisoquinoline-3-carboxylate |
| SMILES | CCNC(=O)OCCCOC(=O)C1CC2CC(CC/C(N)=N/NN)CCC2CN1 |
| InChI | InChI=1S/C19H36N6O4/c1-2-22-19(27)29-9-3-8-28-18(26)16-11-15-10-13(4-6-14(15)12-23-16)5-7-17(20)24-25-21/h13-16,23,25H,2-12,21H2,1H3,(H2,20,24)(H,22,27) |
| InChIKey | NYQIGEHASAZNED-UHFFFAOYSA-N |
| XLogP | 0.58 |
| TPSA | 153.09 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.54 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|