C20H28ClNO4 — CID 162000510
methyl (3S,4aR,6S,8aR)-6-[(4-methoxycarbonylphenyl)methyl]-1,2,3,4,4a,5,6,7,8,8a-decahydroisoquinoline-3-carboxylate;hydrochloride (PubChem CID 162000510) has the molecular formula C20H28ClNO4 and a molecular weight of 381.90 g/mol. Its IUPAC name is methyl (3S,4aR,6S,8aR)-6-[(4-methoxycarbonylphenyl)methyl]-1,2,3,4,4a,5,6,7,8,8a-decahydroisoquinoline-3-carboxylate;hydrochloride.
| Compound Name | methyl (3S,4aR,6S,8aR)-6-[(4-methoxycarbonylphenyl)methyl]-1,2,3,4,4a,5,6,7,8,8a-decahydroisoquinoline-3-carboxylate;hydrochloride |
|---|---|
| PubChem CID | 162000510 |
| Molecular Formula | C20H28ClNO4 |
| Molecular Weight | 381.90 g/mol |
| Exact Mass | 381.17 |
| IUPAC Name | methyl (3S,4aR,6S,8aR)-6-[(4-methoxycarbonylphenyl)methyl]-1,2,3,4,4a,5,6,7,8,8a-decahydroisoquinoline-3-carboxylate;hydrochloride |
| SMILES | COC(=O)c1ccc(C[C@H]2CC[C@H]3CN[C@H](C(=O)OC)C[C@H]3C2)cc1.Cl |
| InChI | InChI=1S/C20H27NO4.ClH/c1-24-19(22)15-6-3-13(4-7-15)9-14-5-8-16-12-21-18(20(23)25-2)11-17(16)10-14;/h3-4,6-7,14,16-18,21H,5,8-12H2,1-2H3;1H/t14-,16+,17-,18+;/m1./s1 |
| InChIKey | NNTLQXKTORJRQO-AMGVKYAUSA-N |
| XLogP | 3.00 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.90 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |