C18H23NO3 — CID 160813755
methyl 4-[(2R)-4-[(4R)-3-azabicyclo[4.1.0]heptan-4-yl]-4-oxobutan-2-yl]benzoate (PubChem CID 160813755) has the molecular formula C18H23NO3 and a molecular weight of 301.39 g/mol. Its IUPAC name is methyl 4-[(2R)-4-[(4R)-3-azabicyclo[4.1.0]heptan-4-yl]-4-oxobutan-2-yl]benzoate.
| Compound Name | methyl 4-[(2R)-4-[(4R)-3-azabicyclo[4.1.0]heptan-4-yl]-4-oxobutan-2-yl]benzoate |
|---|---|
| PubChem CID | 160813755 |
| Molecular Formula | C18H23NO3 |
| Molecular Weight | 301.39 g/mol |
| Exact Mass | 301.17 |
| IUPAC Name | methyl 4-[(2R)-4-[(4R)-3-azabicyclo[4.1.0]heptan-4-yl]-4-oxobutan-2-yl]benzoate |
| SMILES | COC(=O)c1ccc([C@H](C)CC(=O)[C@H]2CC3CC3CN2)cc1 |
| InChI | InChI=1S/C18H23NO3/c1-11(12-3-5-13(6-4-12)18(21)22-2)7-17(20)16-9-14-8-15(14)10-19-16/h3-6,11,14-16,19H,7-10H2,1-2H3/t11-,14?,15?,16-/m1/s1 |
| InChIKey | SEQDLYGTSDIXRR-JGVXXWTJSA-N |
| XLogP | 2.53 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.39 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |