C25H31NO4 — CID 147911505
methyl 4-[(2R)-4-oxo-4-[(2R)-1-(2-phenoxyethyl)piperidin-2-yl]butan-2-yl]benzoate (PubChem CID 147911505) has the molecular formula C25H31NO4 and a molecular weight of 409.53 g/mol. Its IUPAC name is methyl 4-[(2R)-4-oxo-4-[(2R)-1-(2-phenoxyethyl)piperidin-2-yl]butan-2-yl]benzoate.
| Compound Name | methyl 4-[(2R)-4-oxo-4-[(2R)-1-(2-phenoxyethyl)piperidin-2-yl]butan-2-yl]benzoate |
|---|---|
| PubChem CID | 147911505 |
| Molecular Formula | C25H31NO4 |
| Molecular Weight | 409.53 g/mol |
| Exact Mass | 409.23 |
| IUPAC Name | methyl 4-[(2R)-4-oxo-4-[(2R)-1-(2-phenoxyethyl)piperidin-2-yl]butan-2-yl]benzoate |
| SMILES | COC(=O)c1ccc([C@H](C)CC(=O)[C@H]2CCCCN2CCOc2ccccc2)cc1 |
| InChI | InChI=1S/C25H31NO4/c1-19(20-11-13-21(14-12-20)25(28)29-2)18-24(27)23-10-6-7-15-26(23)16-17-30-22-8-4-3-5-9-22/h3-5,8-9,11-14,19,23H,6-7,10,15-18H2,1-2H3/t19-,23-/m1/s1 |
| InChIKey | IGFNLVFMZYFRSM-AUSIDOKSSA-N |
| XLogP | 4.47 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.53 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |