C24H30N2O4 — CID 122220426
methyl 4-[(1R)-1-[[(2S)-1-(2-phenoxyethyl)piperidine-2-carbonyl]amino]ethyl]benzoate (PubChem CID 122220426) has the molecular formula C24H30N2O4 and a molecular weight of 410.51 g/mol. Its IUPAC name is methyl 4-[(1R)-1-[[(2S)-1-(2-phenoxyethyl)piperidine-2-carbonyl]amino]ethyl]benzoate.
| Compound Name | methyl 4-[(1R)-1-[[(2S)-1-(2-phenoxyethyl)piperidine-2-carbonyl]amino]ethyl]benzoate |
|---|---|
| PubChem CID | 122220426 |
| Molecular Formula | C24H30N2O4 |
| Molecular Weight | 410.51 g/mol |
| Exact Mass | 410.22 |
| IUPAC Name | methyl 4-[(1R)-1-[[(2S)-1-(2-phenoxyethyl)piperidine-2-carbonyl]amino]ethyl]benzoate |
| SMILES | COC(=O)c1ccc([C@@H](C)NC(=O)[C@@H]2CCCCN2CCOc2ccccc2)cc1 |
| InChI | InChI=1S/C24H30N2O4/c1-18(19-11-13-20(14-12-19)24(28)29-2)25-23(27)22-10-6-7-15-26(22)16-17-30-21-8-4-3-5-9-21/h3-5,8-9,11-14,18,22H,6-7,10,15-17H2,1-2H3,(H,25,27)/t18-,22+/m1/s1 |
| InChIKey | DRSFYQKBJYLNKT-GCJKJVERSA-N |
| XLogP | 3.58 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.51 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |