C24H30N2O4 — CID 122547125
4-[(1S)-1-[[2-methyl-1-(2-phenoxyethyl)piperidine-2-carbonyl]amino]ethyl]benzoic acid (PubChem CID 122547125) has the molecular formula C24H30N2O4 and a molecular weight of 410.51 g/mol. Its IUPAC name is 4-[(1S)-1-[[2-methyl-1-(2-phenoxyethyl)piperidine-2-carbonyl]amino]ethyl]benzoic acid.
| Compound Name | 4-[(1S)-1-[[2-methyl-1-(2-phenoxyethyl)piperidine-2-carbonyl]amino]ethyl]benzoic acid |
|---|---|
| PubChem CID | 122547125 |
| Molecular Formula | C24H30N2O4 |
| Molecular Weight | 410.51 g/mol |
| Exact Mass | 410.22 |
| IUPAC Name | 4-[(1S)-1-[[2-methyl-1-(2-phenoxyethyl)piperidine-2-carbonyl]amino]ethyl]benzoic acid |
| SMILES | C[C@H](NC(=O)C1(C)CCCCN1CCOc1ccccc1)c1ccc(C(=O)O)cc1 |
| InChI | InChI=1S/C24H30N2O4/c1-18(19-10-12-20(13-11-19)22(27)28)25-23(29)24(2)14-6-7-15-26(24)16-17-30-21-8-4-3-5-9-21/h3-5,8-13,18H,6-7,14-17H2,1-2H3,(H,25,29)(H,27,28)/t18-,24?/m0/s1 |
| InChIKey | WWOXIKYXSNIYHY-VEXWJQHLSA-N |
| XLogP | 3.89 |
| TPSA | 78.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.51 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |