C17H25NO3 — CID 104598488
2-methyl-1-[3-(3-methylphenoxy)propyl]piperidine-2-carboxylic acid (PubChem CID 104598488) has the molecular formula C17H25NO3 and a molecular weight of 291.39 g/mol. Its IUPAC name is 2-methyl-1-[3-(3-methylphenoxy)propyl]piperidine-2-carboxylic acid.
| Compound Name | 2-methyl-1-[3-(3-methylphenoxy)propyl]piperidine-2-carboxylic acid |
|---|---|
| PubChem CID | 104598488 |
| Molecular Formula | C17H25NO3 |
| Molecular Weight | 291.39 g/mol |
| Exact Mass | 291.18 |
| IUPAC Name | 2-methyl-1-[3-(3-methylphenoxy)propyl]piperidine-2-carboxylic acid |
| SMILES | Cc1cccc(OCCCN2CCCCC2(C)C(=O)O)c1 |
| InChI | InChI=1S/C17H25NO3/c1-14-7-5-8-15(13-14)21-12-6-11-18-10-4-3-9-17(18,2)16(19)20/h5,7-8,13H,3-4,6,9-12H2,1-2H3,(H,19,20) |
| InChIKey | YOKKNPKHCQDXAU-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.39 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|