C24H29ClF2N2O4 — CID 163364986
4-[(1S)-1-[[4,4-difluoro-1-(2-phenoxyethylamino)cyclohexanecarbonyl]amino]ethyl]benzoic acid;hydrochloride (PubChem CID 163364986) has the molecular formula C24H29ClF2N2O4 and a molecular weight of 482.96 g/mol. Its IUPAC name is 4-[(1S)-1-[[4,4-difluoro-1-(2-phenoxyethylamino)cyclohexanecarbonyl]amino]ethyl]benzoic acid;hydrochloride.
| Compound Name | 4-[(1S)-1-[[4,4-difluoro-1-(2-phenoxyethylamino)cyclohexanecarbonyl]amino]ethyl]benzoic acid;hydrochloride |
|---|---|
| PubChem CID | 163364986 |
| Molecular Formula | C24H29ClF2N2O4 |
| Molecular Weight | 482.96 g/mol |
| Exact Mass | 482.18 |
| IUPAC Name | 4-[(1S)-1-[[4,4-difluoro-1-(2-phenoxyethylamino)cyclohexanecarbonyl]amino]ethyl]benzoic acid;hydrochloride |
| SMILES | C[C@H](NC(=O)C1(NCCOc2ccccc2)CCC(F)(F)CC1)c1ccc(C(=O)O)cc1.Cl |
| InChI | InChI=1S/C24H28F2N2O4.ClH/c1-17(18-7-9-19(10-8-18)21(29)30)28-22(31)23(11-13-24(25,26)14-12-23)27-15-16-32-20-5-3-2-4-6-20;/h2-10,17,27H,11-16H2,1H3,(H,28,31)(H,29,30);1H/t17-;/m0./s1 |
| InChIKey | ZMWSUGOYMMLHIG-LMOVPXPDSA-N |
| XLogP | 4.60 |
| TPSA | 87.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.96 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|