C25H33N3O4 — CID 163364975
methyl 4-[(1S)-1-[[1-methyl-4-(2-phenoxyethylamino)piperidine-4-carbonyl]amino]ethyl]benzoate (PubChem CID 163364975) has the molecular formula C25H33N3O4 and a molecular weight of 439.56 g/mol. Its IUPAC name is methyl 4-[(1S)-1-[[1-methyl-4-(2-phenoxyethylamino)piperidine-4-carbonyl]amino]ethyl]benzoate.
| Compound Name | methyl 4-[(1S)-1-[[1-methyl-4-(2-phenoxyethylamino)piperidine-4-carbonyl]amino]ethyl]benzoate |
|---|---|
| PubChem CID | 163364975 |
| Molecular Formula | C25H33N3O4 |
| Molecular Weight | 439.56 g/mol |
| Exact Mass | 439.25 |
| IUPAC Name | methyl 4-[(1S)-1-[[1-methyl-4-(2-phenoxyethylamino)piperidine-4-carbonyl]amino]ethyl]benzoate |
| SMILES | COC(=O)c1ccc([C@H](C)NC(=O)C2(NCCOc3ccccc3)CCN(C)CC2)cc1 |
| InChI | InChI=1S/C25H33N3O4/c1-19(20-9-11-21(12-10-20)23(29)31-3)27-24(30)25(13-16-28(2)17-14-25)26-15-18-32-22-7-5-4-6-8-22/h4-12,19,26H,13-18H2,1-3H3,(H,27,30)/t19-/m0/s1 |
| InChIKey | VAYKSWFJAUPRDE-IBGZPJMESA-N |
| XLogP | 2.78 |
| TPSA | 79.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.56 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|