C20H30FN5O2 — CID 162432845
benzyl (6S)-6-[(3Z)-3-amino-3-(aminohydrazinylidene)propyl]-6-fluoro-2,3,4,4a,5,7,8,8a-octahydro-1H-isoquinoline-3-carboxylate (PubChem CID 162432845) has the molecular formula C20H30FN5O2 and a molecular weight of 391.49 g/mol. Its IUPAC name is benzyl (6S)-6-[(3Z)-3-amino-3-(aminohydrazinylidene)propyl]-6-fluoro-2,3,4,4a,5,7,8,8a-octahydro-1H-isoquinoline-3-carboxylate.
| Compound Name | benzyl (6S)-6-[(3Z)-3-amino-3-(aminohydrazinylidene)propyl]-6-fluoro-2,3,4,4a,5,7,8,8a-octahydro-1H-isoquinoline-3-carboxylate |
|---|---|
| PubChem CID | 162432845 |
| Molecular Formula | C20H30FN5O2 |
| Molecular Weight | 391.49 g/mol |
| Exact Mass | 391.24 |
| IUPAC Name | benzyl (6S)-6-[(3Z)-3-amino-3-(aminohydrazinylidene)propyl]-6-fluoro-2,3,4,4a,5,7,8,8a-octahydro-1H-isoquinoline-3-carboxylate |
| SMILES | NN/N=C(\N)CC[C@@]1(F)CCC2CNC(C(=O)OCc3ccccc3)CC2C1 |
| InChI | InChI=1S/C20H30FN5O2/c21-20(9-7-18(22)25-26-23)8-6-15-12-24-17(10-16(15)11-20)19(27)28-13-14-4-2-1-3-5-14/h1-5,15-17,24,26H,6-13,23H2,(H2,22,25)/t15?,16?,17?,20-/m0/s1 |
| InChIKey | SWWBJVLZQFUXTP-ZHHSLPHTSA-N |
| XLogP | 1.73 |
| TPSA | 114.76 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.49 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|