C13H15F2NO2 — CID 163225863
benzyl (2S,4R)-4-fluoro-4-(fluoromethyl)pyrrolidine-2-carboxylate (PubChem CID 163225863) has the molecular formula C13H15F2NO2 and a molecular weight of 255.26 g/mol. Its IUPAC name is benzyl (2S,4R)-4-fluoro-4-(fluoromethyl)pyrrolidine-2-carboxylate.
| Compound Name | benzyl (2S,4R)-4-fluoro-4-(fluoromethyl)pyrrolidine-2-carboxylate |
|---|---|
| PubChem CID | 163225863 |
| Molecular Formula | C13H15F2NO2 |
| Molecular Weight | 255.26 g/mol |
| Exact Mass | 255.11 |
| IUPAC Name | benzyl (2S,4R)-4-fluoro-4-(fluoromethyl)pyrrolidine-2-carboxylate |
| SMILES | O=C(OCc1ccccc1)[C@@H]1C[C@](F)(CF)CN1 |
| InChI | InChI=1S/C13H15F2NO2/c14-8-13(15)6-11(16-9-13)12(17)18-7-10-4-2-1-3-5-10/h1-5,11,16H,6-9H2/t11-,13-/m0/s1 |
| InChIKey | KVXWBHUNHYGLOT-AAEUAGOBSA-N |
| XLogP | 1.77 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.26 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |