C20H36FN5O2 — CID 168971573
acetylene;pentan-3-yl (6S)-6-[(3Z)-3-amino-3-(aminohydrazinylidene)propyl]-6-fluoro-2,3,4,4a,5,7,8,8a-octahydro-1H-isoquinoline-3-carboxylate (PubChem CID 168971573) has the molecular formula C20H36FN5O2 and a molecular weight of 397.54 g/mol. Its IUPAC name is acetylene;pentan-3-yl (6S)-6-[(3Z)-3-amino-3-(aminohydrazinylidene)propyl]-6-fluoro-2,3,4,4a,5,7,8,8a-octahydro-1H-isoquinoline-3-carboxylate.
| Compound Name | acetylene;pentan-3-yl (6S)-6-[(3Z)-3-amino-3-(aminohydrazinylidene)propyl]-6-fluoro-2,3,4,4a,5,7,8,8a-octahydro-1H-isoquinoline-3-carboxylate |
|---|---|
| PubChem CID | 168971573 |
| Molecular Formula | C20H36FN5O2 |
| Molecular Weight | 397.54 g/mol |
| Exact Mass | 397.29 |
| IUPAC Name | acetylene;pentan-3-yl (6S)-6-[(3Z)-3-amino-3-(aminohydrazinylidene)propyl]-6-fluoro-2,3,4,4a,5,7,8,8a-octahydro-1H-isoquinoline-3-carboxylate |
| SMILES | C#C.CCC(CC)OC(=O)C1CC2C[C@@](F)(CC/C(N)=N/NN)CCC2CN1 |
| InChI | InChI=1S/C18H34FN5O2.C2H2/c1-3-14(4-2)26-17(25)15-9-13-10-18(19,7-5-12(13)11-22-15)8-6-16(20)23-24-21;1-2/h12-15,22,24H,3-11,21H2,1-2H3,(H2,20,23);1-2H/t12?,13?,15?,18-;/m0./s1 |
| InChIKey | KHHBXZQVCKGWDB-RKQQXJIQSA-N |
| XLogP | 1.97 |
| TPSA | 114.76 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.54 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|