C22H45N7O3 — CID 168971598
3-[[2-(methylamino)acetyl]amino]propyl 6-[(3Z)-3-amino-3-(aminohydrazinylidene)propyl]-1,2,3,4,4a,5,6,7,8,8a-decahydroisoquinoline-3-carboxylate;propane (PubChem CID 168971598) has the molecular formula C22H45N7O3 and a molecular weight of 455.65 g/mol. Its IUPAC name is 3-[[2-(methylamino)acetyl]amino]propyl 6-[(3Z)-3-amino-3-(aminohydrazinylidene)propyl]-1,2,3,4,4a,5,6,7,8,8a-decahydroisoquinoline-3-carboxylate;propane.
| Compound Name | 3-[[2-(methylamino)acetyl]amino]propyl 6-[(3Z)-3-amino-3-(aminohydrazinylidene)propyl]-1,2,3,4,4a,5,6,7,8,8a-decahydroisoquinoline-3-carboxylate;propane |
|---|---|
| PubChem CID | 168971598 |
| Molecular Formula | C22H45N7O3 |
| Molecular Weight | 455.65 g/mol |
| Exact Mass | 455.36 |
| IUPAC Name | 3-[[2-(methylamino)acetyl]amino]propyl 6-[(3Z)-3-amino-3-(aminohydrazinylidene)propyl]-1,2,3,4,4a,5,6,7,8,8a-decahydroisoquinoline-3-carboxylate;propane |
| SMILES | CCC.CNCC(=O)NCCCOC(=O)C1CC2CC(CC/C(N)=N/NN)CCC2CN1 |
| InChI | InChI=1S/C19H37N7O3.C3H8/c1-22-12-18(27)23-7-2-8-29-19(28)16-10-15-9-13(3-5-14(15)11-24-16)4-6-17(20)25-26-21;1-3-2/h13-16,22,24,26H,2-12,21H2,1H3,(H2,20,25)(H,23,27);3H2,1-2H3 |
| InChIKey | HITFHIQPSGKZGZ-UHFFFAOYSA-N |
| XLogP | 0.58 |
| TPSA | 155.89 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.65 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|