C17H31N5O3 — CID 168971580
(4-amino-4-oxobutyl) 6-[(3Z)-3-amino-3-hydrazinylidenepropyl]-1,2,3,4,4a,5,6,7,8,8a-decahydroisoquinoline-3-carboxylate (PubChem CID 168971580) has the molecular formula C17H31N5O3 and a molecular weight of 353.47 g/mol. Its IUPAC name is (4-amino-4-oxobutyl) 6-[(3Z)-3-amino-3-hydrazinylidenepropyl]-1,2,3,4,4a,5,6,7,8,8a-decahydroisoquinoline-3-carboxylate.
| Compound Name | (4-amino-4-oxobutyl) 6-[(3Z)-3-amino-3-hydrazinylidenepropyl]-1,2,3,4,4a,5,6,7,8,8a-decahydroisoquinoline-3-carboxylate |
|---|---|
| PubChem CID | 168971580 |
| Molecular Formula | C17H31N5O3 |
| Molecular Weight | 353.47 g/mol |
| Exact Mass | 353.24 |
| IUPAC Name | (4-amino-4-oxobutyl) 6-[(3Z)-3-amino-3-hydrazinylidenepropyl]-1,2,3,4,4a,5,6,7,8,8a-decahydroisoquinoline-3-carboxylate |
| SMILES | N/N=C(\N)CCC1CCC2CNC(C(=O)OCCCC(N)=O)CC2C1 |
| InChI | InChI=1S/C17H31N5O3/c18-15(22-20)6-4-11-3-5-12-10-21-14(9-13(12)8-11)17(24)25-7-1-2-16(19)23/h11-14,21H,1-10,20H2,(H2,18,22)(H2,19,23) |
| InChIKey | XTWNECNJLLLLDR-UHFFFAOYSA-N |
| XLogP | 0.20 |
| TPSA | 145.82 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.47 |
| LogP ≤ 5 | 0.20 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|