C20H36FNO2 — CID 168971458
2-ethylbutyl 6-butyl-6-fluoro-2,3,4,4a,5,7,8,8a-octahydro-1H-isoquinoline-3-carboxylate (PubChem CID 168971458) has the molecular formula C20H36FNO2 and a molecular weight of 341.51 g/mol. Its IUPAC name is 2-ethylbutyl 6-butyl-6-fluoro-2,3,4,4a,5,7,8,8a-octahydro-1H-isoquinoline-3-carboxylate.
| Compound Name | 2-ethylbutyl 6-butyl-6-fluoro-2,3,4,4a,5,7,8,8a-octahydro-1H-isoquinoline-3-carboxylate |
|---|---|
| PubChem CID | 168971458 |
| Molecular Formula | C20H36FNO2 |
| Molecular Weight | 341.51 g/mol |
| Exact Mass | 341.27 |
| IUPAC Name | 2-ethylbutyl 6-butyl-6-fluoro-2,3,4,4a,5,7,8,8a-octahydro-1H-isoquinoline-3-carboxylate |
| SMILES | CCCCC1(F)CCC2CNC(C(=O)OCC(CC)CC)CC2C1 |
| InChI | InChI=1S/C20H36FNO2/c1-4-7-9-20(21)10-8-16-13-22-18(11-17(16)12-20)19(23)24-14-15(5-2)6-3/h15-18,22H,4-14H2,1-3H3 |
| InChIKey | GKHDKBWANKAKBL-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.51 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |