C9H17FN2O — CID 153177317
(2S)-4-butyl-4-fluoropyrrolidine-2-carboxamide (PubChem CID 153177317) has the molecular formula C9H17FN2O and a molecular weight of 188.25 g/mol. Its IUPAC name is (2S)-4-butyl-4-fluoropyrrolidine-2-carboxamide.
| Compound Name | (2S)-4-butyl-4-fluoropyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 153177317 |
| Molecular Formula | C9H17FN2O |
| Molecular Weight | 188.25 g/mol |
| Exact Mass | 188.13 |
| IUPAC Name | (2S)-4-butyl-4-fluoropyrrolidine-2-carboxamide |
| SMILES | CCCCC1(F)CN[C@H](C(N)=O)C1 |
| InChI | InChI=1S/C9H17FN2O/c1-2-3-4-9(10)5-7(8(11)13)12-6-9/h7,12H,2-6H2,1H3,(H2,11,13)/t7-,9?/m0/s1 |
| InChIKey | WFLISONYUKIWQT-JAVCKPHESA-N |
| XLogP | 0.73 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.25 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |