C26H48O — CID 178033195
1,3-dibutyl-5-pentyladamantane;propan-2-one (PubChem CID 178033195) has the molecular formula C26H48O and a molecular weight of 376.67 g/mol. Its IUPAC name is 1,3-dibutyl-5-pentyladamantane;propan-2-one.
| Compound Name | 1,3-dibutyl-5-pentyladamantane;propan-2-one |
|---|---|
| PubChem CID | 178033195 |
| Molecular Formula | C26H48O |
| Molecular Weight | 376.67 g/mol |
| Exact Mass | 376.37 |
| IUPAC Name | 1,3-dibutyl-5-pentyladamantane;propan-2-one |
| SMILES | CC(C)=O.CCCCCC12CC3CC(CCCC)(CC(CCCC)(C3)C1)C2 |
| InChI | InChI=1S/C23H42.C3H6O/c1-4-7-10-13-23-16-20-14-21(18-23,11-8-5-2)17-22(15-20,19-23)12-9-6-3;1-3(2)4/h20H,4-19H2,1-3H3;1-2H3 |
| InChIKey | YRWLCWANYIGGCE-UHFFFAOYSA-N |
| XLogP | 8.50 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.67 |
| LogP ≤ 5 | 8.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|