C36H62 — CID 58203019
1-butan-2-yl-3-butyl-5-(3,5-dibutyl-1-adamantyl)adamantane (PubChem CID 58203019) has the molecular formula C36H62 and a molecular weight of 494.89 g/mol. Its IUPAC name is 1-butan-2-yl-3-butyl-5-(3,5-dibutyl-1-adamantyl)adamantane.
| Compound Name | 1-butan-2-yl-3-butyl-5-(3,5-dibutyl-1-adamantyl)adamantane |
|---|---|
| PubChem CID | 58203019 |
| Molecular Formula | C36H62 |
| Molecular Weight | 494.89 g/mol |
| Exact Mass | 494.49 |
| IUPAC Name | 1-butan-2-yl-3-butyl-5-(3,5-dibutyl-1-adamantyl)adamantane |
| SMILES | CCCCC12CC3CC(CCCC)(C1)CC(C14CC5CC(CCCC)(CC(C(C)CC)(C5)C1)C4)(C3)C2 |
| InChI | InChI=1S/C36H62/c1-6-10-13-31-16-29-17-32(22-31,14-11-7-2)25-35(20-29,24-31)36-21-30-18-33(26-36,15-12-8-3)23-34(19-30,27-36)28(5)9-4/h28-30H,6-27H2,1-5H3 |
| InChIKey | CKWMUMPDNKYVLH-UHFFFAOYSA-N |
| XLogP | 11.52 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.89 |
| LogP ≤ 5 | 11.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |