C18H32ClFN2O5S — CID 72773011
4-butyl-N-[2-chloro-1-(3,4,5-trihydroxy-6-methylsulfanyloxan-2-yl)propyl]-4-fluoropyrrolidine-2-carboxamide (PubChem CID 72773011) has the molecular formula C18H32ClFN2O5S and a molecular weight of 442.98 g/mol. Its IUPAC name is 4-butyl-N-[2-chloro-1-(3,4,5-trihydroxy-6-methylsulfanyloxan-2-yl)propyl]-4-fluoropyrrolidine-2-carboxamide.
| Compound Name | 4-butyl-N-[2-chloro-1-(3,4,5-trihydroxy-6-methylsulfanyloxan-2-yl)propyl]-4-fluoropyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 72773011 |
| Molecular Formula | C18H32ClFN2O5S |
| Molecular Weight | 442.98 g/mol |
| Exact Mass | 442.17 |
| IUPAC Name | 4-butyl-N-[2-chloro-1-(3,4,5-trihydroxy-6-methylsulfanyloxan-2-yl)propyl]-4-fluoropyrrolidine-2-carboxamide |
| SMILES | CCCCC1(F)CNC(C(=O)NC(C(C)Cl)C2OC(SC)C(O)C(O)C2O)C1 |
| InChI | InChI=1S/C18H32ClFN2O5S/c1-4-5-6-18(20)7-10(21-8-18)16(26)22-11(9(2)19)15-13(24)12(23)14(25)17(27-15)28-3/h9-15,17,21,23-25H,4-8H2,1-3H3,(H,22,26) |
| InChIKey | HOMBFSNQMLWBHF-UHFFFAOYSA-N |
| XLogP | 0.53 |
| TPSA | 111.05 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.98 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|