C21H39ClN2O6S — CID 58667939
(2S,5R)-N-[(1S,2S)-2-chloro-1-[(2R,3R,4S,5R,6R)-3,4,5-trihydroxy-6-methylsulfanyloxan-2-yl]propyl]-5-(3-ethoxypropyl)azepane-2-carboxamide (PubChem CID 58667939) has the molecular formula C21H39ClN2O6S and a molecular weight of 483.07 g/mol. Its IUPAC name is (2S,5R)-N-[(1S,2S)-2-chloro-1-[(2R,3R,4S,5R,6R)-3,4,5-trihydroxy-6-methylsulfanyloxan-2-yl]propyl]-5-(3-ethoxypropyl)azepane-2-carboxamide.
| Compound Name | (2S,5R)-N-[(1S,2S)-2-chloro-1-[(2R,3R,4S,5R,6R)-3,4,5-trihydroxy-6-methylsulfanyloxan-2-yl]propyl]-5-(3-ethoxypropyl)azepane-2-carboxamide |
|---|---|
| PubChem CID | 58667939 |
| Molecular Formula | C21H39ClN2O6S |
| Molecular Weight | 483.07 g/mol |
| Exact Mass | 482.22 |
| IUPAC Name | (2S,5R)-N-[(1S,2S)-2-chloro-1-[(2R,3R,4S,5R,6R)-3,4,5-trihydroxy-6-methylsulfanyloxan-2-yl]propyl]-5-(3-ethoxypropyl)azepane-2-carboxamide |
| SMILES | CCOCCC[C@@H]1CCN[C@H](C(=O)N[C@@H]([C@H]2O[C@H](SC)[C@H](O)[C@@H](O)[C@H]2O)[C@H](C)Cl)CC1 |
| InChI | InChI=1S/C21H39ClN2O6S/c1-4-29-11-5-6-13-7-8-14(23-10-9-13)20(28)24-15(12(2)22)19-17(26)16(25)18(27)21(30-19)31-3/h12-19,21,23,25-27H,4-11H2,1-3H3,(H,24,28)/t12-,13-,14-,15+,16-,17+,18+,19+,21+/m0/s1 |
| InChIKey | FZXZCOXEUFPFIJ-GOPBNFDYSA-N |
| XLogP | 0.84 |
| TPSA | 120.28 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.07 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|