C20H35ClN2O5S — CID 58840623
(2S,4R)-N-[(1S,2S)-2-chloro-1-[(2R,3R,4S,5R,6R)-3,4,5-trihydroxy-6-methylsulfanyloxan-2-yl]propyl]-4-(2-cyclopropylethyl)piperidine-2-carboxamide (PubChem CID 58840623) has the molecular formula C20H35ClN2O5S and a molecular weight of 451.03 g/mol. Its IUPAC name is (2S,4R)-N-[(1S,2S)-2-chloro-1-[(2R,3R,4S,5R,6R)-3,4,5-trihydroxy-6-methylsulfanyloxan-2-yl]propyl]-4-(2-cyclopropylethyl)piperidine-2-carboxamide.
| Compound Name | (2S,4R)-N-[(1S,2S)-2-chloro-1-[(2R,3R,4S,5R,6R)-3,4,5-trihydroxy-6-methylsulfanyloxan-2-yl]propyl]-4-(2-cyclopropylethyl)piperidine-2-carboxamide |
|---|---|
| PubChem CID | 58840623 |
| Molecular Formula | C20H35ClN2O5S |
| Molecular Weight | 451.03 g/mol |
| Exact Mass | 450.20 |
| IUPAC Name | (2S,4R)-N-[(1S,2S)-2-chloro-1-[(2R,3R,4S,5R,6R)-3,4,5-trihydroxy-6-methylsulfanyloxan-2-yl]propyl]-4-(2-cyclopropylethyl)piperidine-2-carboxamide |
| SMILES | CS[C@H]1O[C@H]([C@H](NC(=O)[C@@H]2C[C@H](CCC3CC3)CCN2)[C@H](C)Cl)[C@H](O)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C20H35ClN2O5S/c1-10(21)14(18-16(25)15(24)17(26)20(28-18)29-2)23-19(27)13-9-12(7-8-22-13)6-5-11-3-4-11/h10-18,20,22,24-26H,3-9H2,1-2H3,(H,23,27)/t10-,12+,13-,14+,15-,16+,17+,18+,20+/m0/s1 |
| InChIKey | FGBYLBBLQDXEGM-XBLGEXMISA-N |
| XLogP | 0.83 |
| TPSA | 111.05 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.03 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|