C20H38N2O5S — CID 11742788
(2S,4R)-4-butyl-N-[(1R)-2-methyl-1-[(2R,3R,4S,5R,6R)-3,4,5-trihydroxy-6-methylsulfanyloxan-2-yl]propyl]piperidine-2-carboxamide (PubChem CID 11742788) has the molecular formula C20H38N2O5S and a molecular weight of 418.60 g/mol. Its IUPAC name is (2S,4R)-4-butyl-N-[(1R)-2-methyl-1-[(2R,3R,4S,5R,6R)-3,4,5-trihydroxy-6-methylsulfanyloxan-2-yl]propyl]piperidine-2-carboxamide.
| Compound Name | (2S,4R)-4-butyl-N-[(1R)-2-methyl-1-[(2R,3R,4S,5R,6R)-3,4,5-trihydroxy-6-methylsulfanyloxan-2-yl]propyl]piperidine-2-carboxamide |
|---|---|
| PubChem CID | 11742788 |
| Molecular Formula | C20H38N2O5S |
| Molecular Weight | 418.60 g/mol |
| Exact Mass | 418.25 |
| IUPAC Name | (2S,4R)-4-butyl-N-[(1R)-2-methyl-1-[(2R,3R,4S,5R,6R)-3,4,5-trihydroxy-6-methylsulfanyloxan-2-yl]propyl]piperidine-2-carboxamide |
| SMILES | CCCC[C@@H]1CCN[C@H](C(=O)N[C@H](C(C)C)[C@H]2O[C@H](SC)[C@H](O)[C@@H](O)[C@H]2O)C1 |
| InChI | InChI=1S/C20H38N2O5S/c1-5-6-7-12-8-9-21-13(10-12)19(26)22-14(11(2)3)18-16(24)15(23)17(25)20(27-18)28-4/h11-18,20-21,23-25H,5-10H2,1-4H3,(H,22,26)/t12-,13+,14-,15+,16-,17-,18-,20-/m1/s1 |
| InChIKey | YRMDEVIUSAKDKK-IFDHCQPASA-N |
| XLogP | 0.86 |
| TPSA | 111.05 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.60 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |