C20H38N2O6S — CID 72753113
N-[2-methyl-1-(3,4,5-trihydroxy-6-methylsulfanyloxan-2-yl)propyl]-4-(propoxymethyl)piperidine-2-carboxamide (PubChem CID 72753113) has the molecular formula C20H38N2O6S and a molecular weight of 434.60 g/mol. Its IUPAC name is N-[2-methyl-1-(3,4,5-trihydroxy-6-methylsulfanyloxan-2-yl)propyl]-4-(propoxymethyl)piperidine-2-carboxamide.
| Compound Name | N-[2-methyl-1-(3,4,5-trihydroxy-6-methylsulfanyloxan-2-yl)propyl]-4-(propoxymethyl)piperidine-2-carboxamide |
|---|---|
| PubChem CID | 72753113 |
| Molecular Formula | C20H38N2O6S |
| Molecular Weight | 434.60 g/mol |
| Exact Mass | 434.25 |
| IUPAC Name | N-[2-methyl-1-(3,4,5-trihydroxy-6-methylsulfanyloxan-2-yl)propyl]-4-(propoxymethyl)piperidine-2-carboxamide |
| SMILES | CCCOCC1CCNC(C(=O)NC(C(C)C)C2OC(SC)C(O)C(O)C2O)C1 |
| InChI | InChI=1S/C20H38N2O6S/c1-5-8-27-10-12-6-7-21-13(9-12)19(26)22-14(11(2)3)18-16(24)15(23)17(25)20(28-18)29-4/h11-18,20-21,23-25H,5-10H2,1-4H3,(H,22,26) |
| InChIKey | OOUQMRQKNGYBDO-UHFFFAOYSA-N |
| XLogP | 0.09 |
| TPSA | 120.28 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.60 |
| LogP ≤ 5 | 0.09 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|