C22H42N2O6S — CID 58840451
(2S,4R)-N-[(1R)-2-methyl-1-[(2R,3R,4S,5R,6R)-3,4,5-trihydroxy-6-methylsulfanyloxan-2-yl]propyl]-4-(3-propoxypropyl)piperidine-2-carboxamide (PubChem CID 58840451) has the molecular formula C22H42N2O6S and a molecular weight of 462.65 g/mol. Its IUPAC name is (2S,4R)-N-[(1R)-2-methyl-1-[(2R,3R,4S,5R,6R)-3,4,5-trihydroxy-6-methylsulfanyloxan-2-yl]propyl]-4-(3-propoxypropyl)piperidine-2-carboxamide.
| Compound Name | (2S,4R)-N-[(1R)-2-methyl-1-[(2R,3R,4S,5R,6R)-3,4,5-trihydroxy-6-methylsulfanyloxan-2-yl]propyl]-4-(3-propoxypropyl)piperidine-2-carboxamide |
|---|---|
| PubChem CID | 58840451 |
| Molecular Formula | C22H42N2O6S |
| Molecular Weight | 462.65 g/mol |
| Exact Mass | 462.28 |
| IUPAC Name | (2S,4R)-N-[(1R)-2-methyl-1-[(2R,3R,4S,5R,6R)-3,4,5-trihydroxy-6-methylsulfanyloxan-2-yl]propyl]-4-(3-propoxypropyl)piperidine-2-carboxamide |
| SMILES | CCCOCCC[C@@H]1CCN[C@H](C(=O)N[C@H](C(C)C)[C@H]2O[C@H](SC)[C@H](O)[C@@H](O)[C@H]2O)C1 |
| InChI | InChI=1S/C22H42N2O6S/c1-5-10-29-11-6-7-14-8-9-23-15(12-14)21(28)24-16(13(2)3)20-18(26)17(25)19(27)22(30-20)31-4/h13-20,22-23,25-27H,5-12H2,1-4H3,(H,24,28)/t14-,15+,16-,17+,18-,19-,20-,22-/m1/s1 |
| InChIKey | RZEXRDXJTLATJL-JNEJITLRSA-N |
| XLogP | 0.87 |
| TPSA | 120.28 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.65 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|