C21H39N3O6S — CID 91181722
(2S,4R)-4-(3-ethoxyiminopropyl)-N-[(1R)-2-methyl-1-[(2R,3R,4S,5R,6R)-3,4,5-trihydroxy-6-methylsulfanyloxan-2-yl]propyl]piperidine-2-carboxamide (PubChem CID 91181722) has the molecular formula C21H39N3O6S and a molecular weight of 461.63 g/mol. Its IUPAC name is (2S,4R)-4-(3-ethoxyiminopropyl)-N-[(1R)-2-methyl-1-[(2R,3R,4S,5R,6R)-3,4,5-trihydroxy-6-methylsulfanyloxan-2-yl]propyl]piperidine-2-carboxamide.
| Compound Name | (2S,4R)-4-(3-ethoxyiminopropyl)-N-[(1R)-2-methyl-1-[(2R,3R,4S,5R,6R)-3,4,5-trihydroxy-6-methylsulfanyloxan-2-yl]propyl]piperidine-2-carboxamide |
|---|---|
| PubChem CID | 91181722 |
| Molecular Formula | C21H39N3O6S |
| Molecular Weight | 461.63 g/mol |
| Exact Mass | 461.26 |
| IUPAC Name | (2S,4R)-4-(3-ethoxyiminopropyl)-N-[(1R)-2-methyl-1-[(2R,3R,4S,5R,6R)-3,4,5-trihydroxy-6-methylsulfanyloxan-2-yl]propyl]piperidine-2-carboxamide |
| SMILES | CCON=CCC[C@@H]1CCN[C@H](C(=O)N[C@H](C(C)C)[C@H]2O[C@H](SC)[C@H](O)[C@@H](O)[C@H]2O)C1 |
| InChI | InChI=1S/C21H39N3O6S/c1-5-29-23-9-6-7-13-8-10-22-14(11-13)20(28)24-15(12(2)3)19-17(26)16(25)18(27)21(30-19)31-4/h9,12-19,21-22,25-27H,5-8,10-11H2,1-4H3,(H,24,28)/t13-,14+,15-,16+,17-,18-,19-,21-/m1/s1 |
| InChIKey | XIMHZYAPAGVPED-DERXAXJCSA-N |
| XLogP | 0.47 |
| TPSA | 132.64 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.63 |
| LogP ≤ 5 | 0.47 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|