C23H40N2O8S — CID 58840473
4-[(2R,3R,4S,5R,6R)-4,5-dihydroxy-6-[(1R)-2-methyl-1-[[(2S,4R)-4-propylpiperidine-2-carbonyl]amino]propyl]-2-methylsulfanyloxan-3-yl]oxy-4-oxobutanoic acid (PubChem CID 58840473) has the molecular formula C23H40N2O8S and a molecular weight of 504.65 g/mol. Its IUPAC name is 4-[(2R,3R,4S,5R,6R)-4,5-dihydroxy-6-[(1R)-2-methyl-1-[[(2S,4R)-4-propylpiperidine-2-carbonyl]amino]propyl]-2-methylsulfanyloxan-3-yl]oxy-4-oxobutanoic acid.
| Compound Name | 4-[(2R,3R,4S,5R,6R)-4,5-dihydroxy-6-[(1R)-2-methyl-1-[[(2S,4R)-4-propylpiperidine-2-carbonyl]amino]propyl]-2-methylsulfanyloxan-3-yl]oxy-4-oxobutanoic acid |
|---|---|
| PubChem CID | 58840473 |
| Molecular Formula | C23H40N2O8S |
| Molecular Weight | 504.65 g/mol |
| Exact Mass | 504.25 |
| IUPAC Name | 4-[(2R,3R,4S,5R,6R)-4,5-dihydroxy-6-[(1R)-2-methyl-1-[[(2S,4R)-4-propylpiperidine-2-carbonyl]amino]propyl]-2-methylsulfanyloxan-3-yl]oxy-4-oxobutanoic acid |
| SMILES | CCC[C@@H]1CCN[C@H](C(=O)N[C@H](C(C)C)[C@H]2O[C@H](SC)[C@H](OC(=O)CCC(=O)O)[C@@H](O)[C@H]2O)C1 |
| InChI | InChI=1S/C23H40N2O8S/c1-5-6-13-9-10-24-14(11-13)22(31)25-17(12(2)3)20-18(29)19(30)21(23(33-20)34-4)32-16(28)8-7-15(26)27/h12-14,17-21,23-24,29-30H,5-11H2,1-4H3,(H,25,31)(H,26,27)/t13-,14+,17-,18-,19+,20-,21-,23-/m1/s1 |
| InChIKey | HDCBNUKFXIZSHI-OPPBVOCBSA-N |
| XLogP | 0.88 |
| TPSA | 154.42 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.65 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |