C27H50N2O6 — CID 11352510
[6-[1-[(4-butylpyrrolidine-2-carbonyl)amino]-2-methylpropyl]-4,5-dihydroxy-2-propyloxan-3-yl] hexanoate (PubChem CID 11352510) has the molecular formula C27H50N2O6 and a molecular weight of 498.71 g/mol. Its IUPAC name is [6-[1-[(4-butylpyrrolidine-2-carbonyl)amino]-2-methylpropyl]-4,5-dihydroxy-2-propyloxan-3-yl] hexanoate.
| Compound Name | [6-[1-[(4-butylpyrrolidine-2-carbonyl)amino]-2-methylpropyl]-4,5-dihydroxy-2-propyloxan-3-yl] hexanoate |
|---|---|
| PubChem CID | 11352510 |
| Molecular Formula | C27H50N2O6 |
| Molecular Weight | 498.71 g/mol |
| Exact Mass | 498.37 |
| IUPAC Name | [6-[1-[(4-butylpyrrolidine-2-carbonyl)amino]-2-methylpropyl]-4,5-dihydroxy-2-propyloxan-3-yl] hexanoate |
| SMILES | CCCCCC(=O)OC1C(CCC)OC(C(NC(=O)C2CC(CCCC)CN2)C(C)C)C(O)C1O |
| InChI | InChI=1S/C27H50N2O6/c1-6-9-11-14-21(30)35-25-20(12-8-3)34-26(24(32)23(25)31)22(17(4)5)29-27(33)19-15-18(16-28-19)13-10-7-2/h17-20,22-26,28,31-32H,6-16H2,1-5H3,(H,29,33) |
| InChIKey | FMOJJVHAPFGWJT-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 117.12 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.71 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|