C27H41ClN2O8S — CID 142421254
2-[(2R,3R,4S,5R,6R)-6-[(1S,2S)-2-chloro-1-[[(2S,4R)-4-pentylpyrrolidine-2-carbonyl]amino]propyl]-3,4,5-trihydroxyoxan-2-yl]sulfanylethyl 2-hydroxybenzoate (PubChem CID 142421254) has the molecular formula C27H41ClN2O8S and a molecular weight of 589.15 g/mol. Its IUPAC name is 2-[(2R,3R,4S,5R,6R)-6-[(1S,2S)-2-chloro-1-[[(2S,4R)-4-pentylpyrrolidine-2-carbonyl]amino]propyl]-3,4,5-trihydroxyoxan-2-yl]sulfanylethyl 2-hydroxybenzoate.
| Compound Name | 2-[(2R,3R,4S,5R,6R)-6-[(1S,2S)-2-chloro-1-[[(2S,4R)-4-pentylpyrrolidine-2-carbonyl]amino]propyl]-3,4,5-trihydroxyoxan-2-yl]sulfanylethyl 2-hydroxybenzoate |
|---|---|
| PubChem CID | 142421254 |
| Molecular Formula | C27H41ClN2O8S |
| Molecular Weight | 589.15 g/mol |
| Exact Mass | 588.23 |
| IUPAC Name | 2-[(2R,3R,4S,5R,6R)-6-[(1S,2S)-2-chloro-1-[[(2S,4R)-4-pentylpyrrolidine-2-carbonyl]amino]propyl]-3,4,5-trihydroxyoxan-2-yl]sulfanylethyl 2-hydroxybenzoate |
| SMILES | CCCCC[C@H]1CN[C@H](C(=O)N[C@@H]([C@H]2O[C@H](SCCOC(=O)c3ccccc3O)[C@H](O)[C@@H](O)[C@H]2O)[C@H](C)Cl)C1 |
| InChI | InChI=1S/C27H41ClN2O8S/c1-3-4-5-8-16-13-18(29-14-16)25(35)30-20(15(2)28)24-22(33)21(32)23(34)27(38-24)39-12-11-37-26(36)17-9-6-7-10-19(17)31/h6-7,9-10,15-16,18,20-24,27,29,31-34H,3-5,8,11-14H2,1-2H3,(H,30,35)/t15-,16+,18-,20+,21-,22+,23+,24+,27+/m0/s1 |
| InChIKey | ZDILRMZPBZDQBQ-FWKKSJOGSA-N |
| XLogP | 1.76 |
| TPSA | 157.58 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 589.15 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|