C26H39ClN2O8S — CID 154031799
2-[(2R,3R,4S,5R,6R)-6-[(1S,2S)-1-[[(2S,4R)-4-butylpyrrolidine-2-carbonyl]amino]-2-chloropropyl]-3,4,5-trihydroxyoxan-2-yl]sulfanylethyl 2-hydroxybenzoate (PubChem CID 154031799) has the molecular formula C26H39ClN2O8S and a molecular weight of 575.12 g/mol. Its IUPAC name is 2-[(2R,3R,4S,5R,6R)-6-[(1S,2S)-1-[[(2S,4R)-4-butylpyrrolidine-2-carbonyl]amino]-2-chloropropyl]-3,4,5-trihydroxyoxan-2-yl]sulfanylethyl 2-hydroxybenzoate.
| Compound Name | 2-[(2R,3R,4S,5R,6R)-6-[(1S,2S)-1-[[(2S,4R)-4-butylpyrrolidine-2-carbonyl]amino]-2-chloropropyl]-3,4,5-trihydroxyoxan-2-yl]sulfanylethyl 2-hydroxybenzoate |
|---|---|
| PubChem CID | 154031799 |
| Molecular Formula | C26H39ClN2O8S |
| Molecular Weight | 575.12 g/mol |
| Exact Mass | 574.21 |
| IUPAC Name | 2-[(2R,3R,4S,5R,6R)-6-[(1S,2S)-1-[[(2S,4R)-4-butylpyrrolidine-2-carbonyl]amino]-2-chloropropyl]-3,4,5-trihydroxyoxan-2-yl]sulfanylethyl 2-hydroxybenzoate |
| SMILES | CCCC[C@H]1CN[C@H](C(=O)N[C@@H]([C@H]2O[C@H](SCCOC(=O)c3ccccc3O)[C@H](O)[C@@H](O)[C@H]2O)[C@H](C)Cl)C1 |
| InChI | InChI=1S/C26H39ClN2O8S/c1-3-4-7-15-12-17(28-13-15)24(34)29-19(14(2)27)23-21(32)20(31)22(33)26(37-23)38-11-10-36-25(35)16-8-5-6-9-18(16)30/h5-6,8-9,14-15,17,19-23,26,28,30-33H,3-4,7,10-13H2,1-2H3,(H,29,34)/t14-,15+,17-,19+,20-,21+,22+,23+,26+/m0/s1 |
| InChIKey | SDOZOWWJHDIQOM-VSDRAVLQSA-N |
| XLogP | 1.37 |
| TPSA | 157.58 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 575.12 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|