C27H43N3O9S — CID 153086406
2-[(2R,3R,4S,5R,6R)-3,4,5-trihydroxy-6-[(1R,2R)-2-methoxy-1-[[(2S,4R)-1-methyl-4-propylpyrrolidine-2-carbonyl]amino]propyl]oxan-2-yl]sulfanylethyl 4-amino-2-hydroxybenzoate (PubChem CID 153086406) has the molecular formula C27H43N3O9S and a molecular weight of 585.72 g/mol. Its IUPAC name is 2-[(2R,3R,4S,5R,6R)-3,4,5-trihydroxy-6-[(1R,2R)-2-methoxy-1-[[(2S,4R)-1-methyl-4-propylpyrrolidine-2-carbonyl]amino]propyl]oxan-2-yl]sulfanylethyl 4-amino-2-hydroxybenzoate.
| Compound Name | 2-[(2R,3R,4S,5R,6R)-3,4,5-trihydroxy-6-[(1R,2R)-2-methoxy-1-[[(2S,4R)-1-methyl-4-propylpyrrolidine-2-carbonyl]amino]propyl]oxan-2-yl]sulfanylethyl 4-amino-2-hydroxybenzoate |
|---|---|
| PubChem CID | 153086406 |
| Molecular Formula | C27H43N3O9S |
| Molecular Weight | 585.72 g/mol |
| Exact Mass | 585.27 |
| IUPAC Name | 2-[(2R,3R,4S,5R,6R)-3,4,5-trihydroxy-6-[(1R,2R)-2-methoxy-1-[[(2S,4R)-1-methyl-4-propylpyrrolidine-2-carbonyl]amino]propyl]oxan-2-yl]sulfanylethyl 4-amino-2-hydroxybenzoate |
| SMILES | CCC[C@@H]1C[C@@H](C(=O)N[C@@H]([C@H]2O[C@H](SCCOC(=O)c3ccc(N)cc3O)[C@H](O)[C@@H](O)[C@H]2O)[C@@H](C)OC)N(C)C1 |
| InChI | InChI=1S/C27H43N3O9S/c1-5-6-15-11-18(30(3)13-15)25(35)29-20(14(2)37-4)24-22(33)21(32)23(34)27(39-24)40-10-9-38-26(36)17-8-7-16(28)12-19(17)31/h7-8,12,14-15,18,20-24,27,31-34H,5-6,9-11,13,28H2,1-4H3,(H,29,35)/t14-,15-,18+,20-,21+,22-,23-,24-,27-/m1/s1 |
| InChIKey | VOHKICZAEBEWAQ-FPZXYBNWSA-N |
| XLogP | 0.31 |
| TPSA | 184.04 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 40 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 585.72 |
| LogP ≤ 5 | 0.31 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|