C18H34N2O6S — CID 154578309
(2S,4R)-N-[(2R)-2-hydroxy-1-[(2R,3R,4S,5R,6R)-3,4,5-trihydroxy-6-methylsulfanyloxan-2-yl]propyl]-1-methyl-4-propylpyrrolidine-2-carboxamide (PubChem CID 154578309) has the molecular formula C18H34N2O6S and a molecular weight of 406.55 g/mol. Its IUPAC name is (2S,4R)-N-[(2R)-2-hydroxy-1-[(2R,3R,4S,5R,6R)-3,4,5-trihydroxy-6-methylsulfanyloxan-2-yl]propyl]-1-methyl-4-propylpyrrolidine-2-carboxamide.
| Compound Name | (2S,4R)-N-[(2R)-2-hydroxy-1-[(2R,3R,4S,5R,6R)-3,4,5-trihydroxy-6-methylsulfanyloxan-2-yl]propyl]-1-methyl-4-propylpyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 154578309 |
| Molecular Formula | C18H34N2O6S |
| Molecular Weight | 406.55 g/mol |
| Exact Mass | 406.21 |
| IUPAC Name | (2S,4R)-N-[(2R)-2-hydroxy-1-[(2R,3R,4S,5R,6R)-3,4,5-trihydroxy-6-methylsulfanyloxan-2-yl]propyl]-1-methyl-4-propylpyrrolidine-2-carboxamide |
| SMILES | CCC[C@@H]1C[C@@H](C(=O)NC(C2O[C@H](SC)[C@H](O)[C@@H](O)[C@H]2O)[C@@H](C)O)N(C)C1 |
| InChI | InChI=1S/C18H34N2O6S/c1-5-6-10-7-11(20(3)8-10)17(25)19-12(9(2)21)16-14(23)13(22)15(24)18(26-16)27-4/h9-16,18,21-24H,5-8H2,1-4H3,(H,19,25)/t9-,10-,11+,12?,13+,14-,15-,16?,18-/m1/s1 |
| InChIKey | OJMMVQQUTAEWLP-BFAOHLFOSA-N |
| XLogP | -0.86 |
| TPSA | 122.49 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.55 |
| LogP ≤ 5 | -0.86 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |