C18H36N2O10S2 — CID 68814200
(2S,4R)-N-[(1R,2R)-2-hydroxy-1-[(2R,3R,4S,5R,6R)-3,4,5-trihydroxy-6-methylsulfanyloxan-2-yl]propyl]-1-methyl-4-propylpyrrolidine-2-carboxamide;sulfuric acid (PubChem CID 68814200) has the molecular formula C18H36N2O10S2 and a molecular weight of 504.62 g/mol. Its IUPAC name is (2S,4R)-N-[(1R,2R)-2-hydroxy-1-[(2R,3R,4S,5R,6R)-3,4,5-trihydroxy-6-methylsulfanyloxan-2-yl]propyl]-1-methyl-4-propylpyrrolidine-2-carboxamide;sulfuric acid.
| Compound Name | (2S,4R)-N-[(1R,2R)-2-hydroxy-1-[(2R,3R,4S,5R,6R)-3,4,5-trihydroxy-6-methylsulfanyloxan-2-yl]propyl]-1-methyl-4-propylpyrrolidine-2-carboxamide;sulfuric acid |
|---|---|
| PubChem CID | 68814200 |
| Molecular Formula | C18H36N2O10S2 |
| Molecular Weight | 504.62 g/mol |
| Exact Mass | 504.18 |
| IUPAC Name | (2S,4R)-N-[(1R,2R)-2-hydroxy-1-[(2R,3R,4S,5R,6R)-3,4,5-trihydroxy-6-methylsulfanyloxan-2-yl]propyl]-1-methyl-4-propylpyrrolidine-2-carboxamide;sulfuric acid |
| SMILES | CCC[C@@H]1C[C@@H](C(=O)N[C@@H]([C@H]2O[C@H](SC)[C@H](O)[C@@H](O)[C@H]2O)[C@@H](C)O)N(C)C1.O=S(=O)(O)O |
| InChI | InChI=1S/C18H34N2O6S.H2O4S/c1-5-6-10-7-11(20(3)8-10)17(25)19-12(9(2)21)16-14(23)13(22)15(24)18(26-16)27-4;1-5(2,3)4/h9-16,18,21-24H,5-8H2,1-4H3,(H,19,25);(H2,1,2,3,4)/t9-,10-,11+,12-,13+,14-,15-,16-,18-;/m1./s1 |
| InChIKey | PUYCGERKLUVGMF-BOMBIWCESA-N |
| XLogP | -1.51 |
| TPSA | 197.09 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.62 |
| LogP ≤ 5 | -1.51 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|