C26H38Cl2N2O8S — CID 154031789
2-[(2R,3R,4S,5R,6R)-3,4,5-trihydroxy-6-[(1R,2R)-2-methoxy-1-[[(2S,4R)-4-propylpyrrolidine-2-carbonyl]amino]propyl]oxan-2-yl]sulfanylethyl 3,4-dichlorobenzoate (PubChem CID 154031789) has the molecular formula C26H38Cl2N2O8S and a molecular weight of 609.57 g/mol. Its IUPAC name is 2-[(2R,3R,4S,5R,6R)-3,4,5-trihydroxy-6-[(1R,2R)-2-methoxy-1-[[(2S,4R)-4-propylpyrrolidine-2-carbonyl]amino]propyl]oxan-2-yl]sulfanylethyl 3,4-dichlorobenzoate.
| Compound Name | 2-[(2R,3R,4S,5R,6R)-3,4,5-trihydroxy-6-[(1R,2R)-2-methoxy-1-[[(2S,4R)-4-propylpyrrolidine-2-carbonyl]amino]propyl]oxan-2-yl]sulfanylethyl 3,4-dichlorobenzoate |
|---|---|
| PubChem CID | 154031789 |
| Molecular Formula | C26H38Cl2N2O8S |
| Molecular Weight | 609.57 g/mol |
| Exact Mass | 608.17 |
| IUPAC Name | 2-[(2R,3R,4S,5R,6R)-3,4,5-trihydroxy-6-[(1R,2R)-2-methoxy-1-[[(2S,4R)-4-propylpyrrolidine-2-carbonyl]amino]propyl]oxan-2-yl]sulfanylethyl 3,4-dichlorobenzoate |
| SMILES | CCC[C@H]1CN[C@H](C(=O)N[C@@H]([C@H]2O[C@H](SCCOC(=O)c3ccc(Cl)c(Cl)c3)[C@H](O)[C@@H](O)[C@H]2O)[C@@H](C)OC)C1 |
| InChI | InChI=1S/C26H38Cl2N2O8S/c1-4-5-14-10-18(29-12-14)24(34)30-19(13(2)36-3)23-21(32)20(31)22(33)26(38-23)39-9-8-37-25(35)15-6-7-16(27)17(28)11-15/h6-7,11,13-14,18-23,26,29,31-33H,4-5,8-10,12H2,1-3H3,(H,30,34)/t13-,14-,18+,19-,20+,21-,22-,23-,26-/m1/s1 |
| InChIKey | ZCULWFLAKOHTKU-ABDZRXLRSA-N |
| XLogP | 1.99 |
| TPSA | 146.58 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 609.57 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|